Biotiini

Wikipedia
Loikkaa: valikkoon, hakuun
Biotiini
Biotin structure JA.png
Tunnisteet
CAS-numero 58-85-5
IUPAC-nimi 5-[(3aS,4S,6aR)-2-okso-1,3,3a,4,6,6a-heksahydrotieno[3,4-d]imidatsol-4-yyli]pentaanihappo
SMILES C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2
Ominaisuudet
Kemiallinen kaava C10H16N2O3S
Moolimassa 244,31 g/mol
Sulamispiste 232-233 °C
Liukoisuus 220 mg/l (25°C)[1]

Biotiini eli H- tai B7-vitamiini on rikkiä sisältävä, optisesti aktiivinen orgaaninen happo, jonka biologisesti aktiivinen muoto on D-isomeeri. Biotiini toimii koentsyyminä lukuisten entsymaattisten karboksylaatiotapahtumien katalyyttina. Se osallistuu hiilihydraattien ja rasvojen aineenvaihduntaan eli metaboliaan. Biotiinia syntetisoituu myös suolistossa mikro-organismien toiminnan seurauksena. Ruoka-aineissa biotiinin lähteitä ovat muun muassa hiiva, soijajauho, viljatuotteet, maksa, munuainen ja munan keltuainen.

Biotiinin kemiallinen kaava on C10H16N2O3S, moolimassa 244,31 g/mol ja CAS-numero 58-85-5.

Suomessa biotiinille ei ole annettu tarkkoja saantisuosituksia. Yhdysvalloissa on arvioitu terveen ihmisen käyttävän biotiinia noin 30 mikrogrammaa vuorokaudessa, imetyksen aikana enemmän.[2] Koska biotiinia on yleisesti ruoka-aineissa ja sitä syntyy myös suolistossa, biotiinin puutetta ei yleensä esiinny.[3] Biotiinia markkinoidaan kuitenkin ravintolisänä etenkin hiusten ja kynsien vahvistamiseen ja hiusten lähtöä vastaan.[4][5]

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. : Biotin NLM Viitattu 09.07.2012
  2. Vesiliukoiset vitamiinit Avoin yliopisto. Viitattu 6.8.2013.
  3. Antti Aro: Vitamiinit ja kivennäisaineet terveyskirjasto. 2009. Duodecim. Viitattu 6.8.2013.
  4. Ohuen tukan tuska Kauneus ja terveys. Viitattu 6.8.2013.
  5. B-vitamiinit Lisäravinne.fi. Viitattu 6.8.2013.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.