D2-vitamiini

Wikipedia
Loikkaa: valikkoon, hakuun
D2-vitamiini
Ergocalciferol.svg
Tunnisteet
CAS-numero 50-14-6
SMILES CC(C)C(C)C=CC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C
Ominaisuudet
Kemiallinen kaava C28H44O
Moolimassa 396,648 g/mol
Sulamispiste 115–119 °C
Liukoisuus 50 mg/l (25 °C)[1]

D2-vitamiini tai ergokalsiferoli on vitamiini, jota ei muodostu ihmisen iholla toisin kuin D3-vitamiini ultraviolettisäteilyn seurauksena, vaan on ainoastaan kasviperäistä. Ergokalsiferolia voidaan valmistaa synteettisesti säteilyttämällä ergosterolia ultraviolettivalolla. D2-vitamiinin vaikutus on kolekalsiferolin (C27H44O) eli D3-vitamiinin kaltainen.[2]

Ergokalsiferoli muutetaan maksassa kolekalsiferoliksi ja osa siitä 25-hydroksikalsiferoliksi eli kalsidioliksi. Pieni osa kalsidiolista muuttuu pääasiassa munuaisissa mutta myös paksusuolessa, eturauhasessa, rintarauhasessa ja veren valkosoluissa aktiiviseksi kalsitrioliksi eli 1,25-dihydroksikalsiferoliksi.

Ergokalsiferolin kemiallinen kaava on C28H44O, moolimassa 396,648 g/mol, sulamispiste 115–119 °C ja CAS-numero 50-14-6. Yhdiste on olomuodoltaan kiteistä valkoista jauhetta, joka kuitenkin kellastuu ilman, valon ja lämmön vaikutuksesta. Ergokalsiferoli liukenee etanoliin, asetoniin, etyylietanoaattiin, eetteriin ja rasvaöljyihin.

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. : Ergocalciferol NLM Viitattu 9.7.2012
  2. Turunen, Seppo: Biologia: Ihminen, s. 180. 5.–7. painos. WSOY, 2007. ISBN 978-951-0-29701-8.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]