Kehäkukkahappo

Wikipedia
Loikkaa: valikkoon, hakuun
Kehäkukkahappo
Alpha-calendic acid.svg
Tunnisteet
CAS-numero 5204-87-5
IUPAC-nimi (8E,10E,12Z)-oktadeka-8,10,12-trieenihappo
SMILES O=C(O)CCCCCC\C=C\C=C\C=C/CCCCC
Ominaisuudet
Kemiallinen kaava C18H30O2
Moolimassa 278,43 g/mol g/mol

Kehäkukkahappo (eng. Calendic acid) tai (8E, 10E-12E) -8,10,12-oktadekatrieenihappo on tyydyttymätön omega-6-rasvahappo. Yhdiste on saanut nimensä kehäkukan (Calendula officinalis) mukaan, jossa kyseistä yhdistettä on runsaasti.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Kehäkukka sisältää runsaasti kehäkukkahappoa
Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.