Podokarpiinihappo

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Podokarpiinihappo
5(Z),11(Z),14(Z)-Eicosatrienoic Acid.png
Tunnisteet
CAS-numero 7019-85-4
IUPAC-nimi (5Z,11Z,14Z)-eikosa-5,11,14-trieenihappo
SMILES CCCCC/C=C\C/C=C\CCCC/C=C\CCCC(=O)​O
Ominaisuudet
Kemiallinen kaava C20H34O2
Moolimassa 306,5 g/mol

Podokarpiinihappo on monityydyttymätön rasvahappo.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.