Stearidonihappo

Wikipedia
Loikkaa: valikkoon, hakuun
Stearidonihappo
Stearidonic acid.png
Tunnisteet
CAS-numero 20290-75-9
IUPAC-nimi (6Z,9Z,12Z,15Z)-6,9,12,15-oktadekatetraeenihappo
SMILES O=C(O)CCCC\C=C/C\C=C/C\C=C/C\C=C/CC
Ominaisuudet
Kemiallinen kaava C18H28O2
Moolimassa 276,4 g/mol g/mol

Stearidonihappo (SDA, 18:4n-3) on tyydyttymätön omega-3-rasvahappo. Yhdistettä biosyntetisoidaan alfalinoleenihaposta delta-6-desaturaasi-entsyymin avulla. Yhdistettä esiintyy hampunsiementen öljyssä, mustaherukansiementen öljyssä, peltorusojuurensiementen öljyssä, piiankielensiementen öljyssä sekä Spirulina-syanobakteereissa[1].

Viitteet[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]


Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.