Alfalinoleenihappo

Wikipedia
Loikkaa: valikkoon, hakuun
Alfalinoleenihappo
ALAnumbering.svgLinolenic-acid-3D-vdW.png
Tunnisteet
CAS-numero 463-40-1
IUPAC-nimi (9Z,12Z,15Z)-oktadeka-9,12,15-trieenihappo
SMILES CCC=CCC=CCC=CCCCCCCCC(=O)O
Ominaisuudet
Kemiallinen kaava C18H30O2
Moolimassa 278,43 g/mol
Sulamispiste −16,5 °C[1]

Alfalinoleenihappo, (ALA) eli 9,12,15-oktadekatrieenihappo on ihmiselle välttämätön rasvahappo.

Alfalinoleenihappo on monityydyttymättömien, pitkäketjuisten omega-3-sarjan rasvahappojen esiaste. Alfalinoleenihappo toimii eikosanoidien lähtöaineena. Eikosanoidit ovat hormonien kaltaisia yhdisteitä, joilla on useita fysiologisia tehtäviä verenkiertoelimistössä ja ruoansulatuskanavassa.[2]

Alfalinoleenihappo on gammalinoleenihapon isomeeri. Alfalinoleenihapon kemiallinen kaava on C18H30O2, moolimassa 278,43 g/mol ja CAS-numero 463-40-1.

Saksanpähkinä on hyvä alfalinoleenihapon lähde.

Alfalinoleenihappo hapettuu herkästi. Tämän vuoksi sitä runsaimmin sisältävät kasviöljyt kuten pellavaöljy ovat kuivuvia öljyjä, joiden pinnalle muodostuu vähitellen sitkeä pinta­kalvo. Kuivuneina ne ovat terveydelle haitallisia,selvennä minkä vuoksi ravinnoksi käytettävien kuivuvien öljyjen on oltava hyvin tuoreita. Toisaalta sama ominaisuus tekee pellava­öljyn käyttö­kelpoiseksi maaleissa ja vernissan raaka-aineena. Ehjässä siemenessä öljy ei kuitenkaan hapetu.[3]

Pellavansiemenöljy, hamppuöljy, rypsiöljy ja saksanpähkinä ovat parhaat alfalinoleenihapon lähteet.[4] Muita hyviä lähteitä ovat muut ruokaöljyt, margariinit ja hampunsiemenet.[5]

Suositusten mukaisen vuorokausiannoksen alfalinoleenihappoa saa noin kahdesta ruokalusikallisesta rypsiöljyä[6].

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Linolenic acid NLM Viitattu 13.6.2012
  2. Rasvahappo 18:3 n-3 (alfalinoleenihappo). http://www.fineli.fi/component.php?compid=2097&lang=fi
  3. Arne Rousi: Auringonkukasta viiniköynnökseen, ravintokasvit ihmisen palveluksessa, s. 140. WSOY, 1997. ISBN 9510212954.
  4. Fineli, Eniten ja vähiten sisältävät elintarvikkeet, Rasvahappo 18:3 n-3 (alfalinoleenihappo). http://www.fineli.fi/topfoods.php?compid=2097&fuclass=all&specdiet=none&items=55&from=top&portion=100g&lang=fi suomeksi
  5. Fineli, Eniten ja vähiten sisältävät elintarvikkeet, Rasvahappo 18:3 n-3 (alfalinoleenihappo). http://www.fineli.fi/topfoods.php?compid=2097&fuclass=all&specdiet=none&items=55&from=top&portion=100g&lang=fi suomeksi
  6. Fineli, Eniten ja vähiten sisältävät elintarvikkeet, Rasvahappo 18:3 n-3 (alfalinoleenihappo). http://www.fineli.fi/topfoods.php?compid=2097&fuclass=all&specdiet=none&items=55&from=top&portion=100g&lang=fi suomeksi

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]


Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.