Dokosatetraeenihappo

Wikipedia
Loikkaa: valikkoon, hakuun
Dokosatetraeenihappo
Adrenic acid.png
Tunnisteet
CAS-numero 28874-58-0
IUPAC-nimi 7Z,10Z,13Z,16Z-dokosatetraeenihappo
SMILES OC(CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O
Ominaisuudet
Kemiallinen kaava C22H36O2
Moolimassa 332,5 g/mol g/mol

Dokosatetraeenihappo (triviaalinimi adreenihappo, (22:4, n-6)) on monityydyttymätön omega-6-rasvahappo. Yhdistettä esiintyy kehittyvissä ihmisaivoissa[1].

Viitteet[muokkaa | muokkaa wikitekstiä]

  1. Martinez M: Tissue levels of polyunsaturated fatty acids during early human development. J Pediatr, 1992, 120. vsk, nro 4 Pt 2, s. S129–38.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]