2C-T-2

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
2C-T-2
2C-T-2.svg
Tunnisteet
CAS-numero 207740-24-7
IUPAC-nimi 2-(4-etyylisulfanyyli-2,5-dimetoksifenyyli)etanamiini
SMILES CCSC1=C(C=C(C(=C1)OC)CCN)OC
Ominaisuudet
Kemiallinen kaava C12H19NO2S
Moolimassa 241,35 g/mol
2C-T-2 -jauhetta

2C-T-2 on 2,5-dimetoksi-4-etyylitiofenetyyliamiini ja se kuuluu 2C-huumeluokkaan. Se on psykedeelinen ja enteogeeninen huume.

PiHKAL-kirjan mukaan 2C-T-2:n annostus on 12-25 mg suun kautta ja kesto 6-8 tuntia.[1]

2C-T-2 on luokiteltu huumausaineeksi Suomessa.[2]

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Erowid Online Books : "PIHKAL" - #40 2C-T-2 erowid.org. Viitattu 7.12.2017.
  2. Edita Publishing Oy: FINLEX ® - Ajantasainen lainsäädäntö: Valtioneuvoston asetus huumausaineina… 543/2008 www.finlex.fi. Viitattu 7.12.2017.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]