2C-C

Kohteesta Wikipedia
Loikkaa: valikkoon, hakuun
2C-C
2C-C.svg
Tunnisteet
CAS-numero 88441-14-9
IUPAC-nimi 2-(4-kloori-3-metoksifenyyli)-2-metoksietanamiini
SMILES COC1=C(C=CC(=C1)C(CN)OC)Cl
Ominaisuudet
Kemiallinen kaava C10H14ClNO2
Moolimassa 215,677 g/mol
Sulamispiste 220–221 °C (hydrokloridisuolana)


2C-C:tä sisältäviä lappuja

2C-C on 2C-luokan huume, joka on enteogeeni. Yhdisteen kehitti Alexander Shulgin. Shulginin kirjassa PiHKAL suositellaan annokseksi 20-40 mg ja aineen vaikutuksen kestoksi 4-8 tuntia. 2C-C:tä otetaan suun kautta tai nuuskataan.[1]

Laki[muokkaa | muokkaa wikitekstiä]

2C-C on luokiteltu Suomessa kuluttajamarkkinoilta kielletyksi psykoaktiiviseksi aineeksi.[2]

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Erowid Online Books : "PIHKAL" - #22 2C-C erowid.org. Viitattu 7.12.2017.
  2. Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista Viitattu 9.12.2017.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]