Adenosiinidifosfaatti

Wikipedia
Loikkaa: valikkoon, hakuun
Adenosiinidifosfaatti
ADP chemical structure.png
Tunnisteet
CAS-numero 58-64-0
SMILES C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O
Ominaisuudet
Kemiallinen kaava C10H15N5O10P2
Moolimassa 427,201 g/mol

ADP eli adenosiinidifosfaatti on runsasenergiainen yhdiste, josta muodostuu adenosiinitrifosfaattia eli ATP:tä kun siihen lisätään entsymaattisesti fosfaattiryhmä.[1]

Adenosiinidifosfaatin kemiallinen kaava on C10H15N5O10P2, moolimassa 427,201 g/mol ja CAS-numero 58-64-0.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Veikko Ahola, Irmeli Kuhlman, Jorma Luotio: Tietojätti. Tietosanakirja A–Ö, s. 13. Jyväskylä: Gummerus, 2003.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.