Ibogaiini

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Ibogaiini
Ibogaine.svg
Tunnisteet
CAS-numero 83-74-9
SMILES CCC1CC2CC3C1N(C2)CCC4=C3NC5=C4C=C(C=C5)OC
Ominaisuudet
Kemiallinen kaava C20H26N2O
Moolimassa 310,43 g/mol

Ibogaiini on tryptamiini, jota on käytetty sekä päihteenä että päihteistä vieroitukseen.[1]

Ibogaiinia saadaan keskiafrikkalaisesta ibogapensaasta (Tabernanthe iboga). Paikalliset heimot ovat käyttäneet sitä lääketieteellisissä ja rituaalisissa tarkoituksissa. Eräissä länsimaissa sitä on käytetty opiaattiriippuvaisten hoidossa vieroitusoireiden lieventämiseen.[2]

Ibogaiini on MAO-inhibiittori, joten sen käyttäminen monien lääkeaineiden ja joidenkin ruoka-aineiden kanssa on vaarallista.lähde?

Annostus ja vaikutusten kesto[muokkaa | muokkaa wikitekstiä]

Erowid-sivuston mukaan ainetta käytetään suun kautta ja sopivat annokset vaihtelevat suuresti. 200-1000 mg voivat olla sopivia annoksia viihdekäyttöön. Sivuston mukaan 15-22 mg/kg annokset (annos lasketaan henkilön painosta) sopivat opiaattien vieroitusterapiaan. Vaikutukset saavuttavat huippunsa 45 minuutin tai 3 tunnin välillä annoksen ottamisesta. Vaikutukset kestävät yli 24 tuntia ja jälkivaikutuksia voi tuntea tämän jälkeen vielä 1-2 päivän ajan.[3]

Laki[muokkaa | muokkaa wikitekstiä]

Ibogaiini on luokiteltu Suomessa kuluttajamarkkinoilta kielletyksi psykoaktiiviseksi aineeksi.[4]

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Pirjo Lindfors: Tutkimuksia, kokemuksia ja ajatuksia yhteisöllisyyden terveysvaikutuksista 2007. Psykoterapia-lehti.
  2. Dzoljic et al, PubMed
  3. Erowid Ibogaine Vault: Basics erowid.org. Viitattu 7.12.2017.
  4. Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista finlex.fi. Viitattu 9.12.2017.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä lääketieteeseen liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.