Dietyylitryptamiini

Kohteesta Wikipedia
Loikkaa: valikkoon, hakuun
Dietyylitryptamiini
Diethyltryptamine.svg
Tunnisteet
CAS-numero 7558-72-7
IUPAC-nimi N,N-dietyyli-2-(1H-indol-3-yyli)etanamiini
SMILES CCN(CC)CCC1=CNC2=CC=CC=C21
Ominaisuudet
Kemiallinen kaava C14H20N2
Moolimassa 216,32 g/mol
Sulamispiste 169–171 °C

Dietyylitryptamiini (DET) eli N,N-dietyylitryptamiini on tryptamiineihin kuuluva huumausaine. Aine kuuluu tryptamiineihin, joihin kuuluvia huumeita ovat myös esimerkiksi joidenkin huumesienien sisältämä psilosybiini, sekä dimetyylitryptamiini (DMT).

Annostus ja vaikutukset[muokkaa | muokkaa wikitekstiä]

Erowid-sivun mukaan tyypillinen annos on 40-60 mg poltettuna/vaporisoituna. Täydet vaikutukset ilmenevät 2-5 minuutissa annoksen vaporisoinnista. Syötynä tyypillinen annos on 50-100 mg. Täydet vaikutukset ilmenevät 40-90 minuutissa ja kestävät 2-4 tuntia.[1]

Lainsäädäntö[muokkaa | muokkaa wikitekstiä]

DET on Suomessa luokiteltu laittomaksi huumausaineeksi.[2]

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Erowid DET Vault : Dosage erowid.org. Viitattu 7.12.2017.
  2. http://www.finlex.fi/fi/laki/alkup/1996/19960704

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]