Ero sivun ”Ranitidiini” versioiden välillä

Siirry navigaatioon Siirry hakuun
972 merkkiä lisätty ,  8 vuotta sitten
[katsottu versio][katsottu versio]
p (kh fix)
| IUPAC_nimi = (E)-1-N'-[2-<nowiki>[[</nowiki>5-[(dimetyyliamino)metyyli]furan-2-yyli]metyylisulfanyyli]etyyli]-1-N-metyyli-2-nitroeteeni-1,1-diamiini
| image = Ranitidine Structural Formulae.png
| width = 250
| CAS_numero = 66357-35-5
| ATC_prefiksi = A02
| ATC_suffiksi = BA02
| ATC_lisätiedot =
| PubChem = 3001055
| DrugBank = DB00863
| C=13 | H=22 | S=1 | N=4 | O=3
| moolimassa = 314,4
| smiles = CNC(=C[N+](=O)[O-])NCCSCC1=CC=C(O1)CN(C)C
| synonyymit =
| tiheys =
| sulamispiste =
| sulamis_ylempi =
| sulamishuomiot =
| kiehumispiste =
| kiehumis_ylempi =
| kiehumishuomiot =
| liukoisuus =
| biosaatavuus = 39-88 %
| proteiinisitoutuminen = 15 %
| metabolismi = [[Maksa|Hepaattinen]]
| eliminaation_puoliintumisaika = 2-3 h
| ekskreetio = [[Munuaiset|Renaalinen]]
| raskaus_AU =
| raskaus_US =
| resepti_AU =
| resepti_CA =
| resepti_UK =
| resepti_US =
| reseptiluokitus =
| valmisteen_antotapa = Oraalinen, intravenoosi
'''Ranitidiini''' on eräs [[antihistamiini]] ja [[lääkeaine]]. Se on H2 -reseptoreja salpaava aine, jota käytetään [[vatsa]]n liikahappoisuudesta johtuvaan [[Närästys|närästykseen]].<ref> (Viitattu 26.8. 2014)</ref>
139 326

