Tetrodotoksiini

Wikipedia
Loikkaa: valikkoon, hakuun
Tetrodotoksiini
Tetrodotoxin-2D-skeletal.png
Tunnisteet
CAS-numero 4368-28-9
SMILES C(C1(C2C3C([NH+]=C(NC34C(C1OC(C4O)(O2)[O-])O)N)O)O)O
Ominaisuudet
Kemiallinen kaava C11H17N3O8
Moolimassa 319,268 g/mol

Tetrodotoksiini (C11H17N3O8) on eräissä eläimissä tavattava voimakas hermomyrkky. Sitä tuottaa bakteeri, joka elää symbioosissa joidenkin vaihtolämpöisten eläinten kanssa. Myrkky tunnetaan parhaiten pallokalojen myrkkynä, mutta sitä on löydetty myös sammakkoeläimistä, meritähdistä, tursaista ja madoista.[1]

Myrkytys aiheuttaa pahoinvointia ja halvaantumisen, joka johtaa kuolemaan.[1] Se vaikuttaa tukkimalla hermojen natriumkanavat.[2] Eräät tutkijat ovat esittäneet, että pientä määrää tetrodotoksiinia olisi käytetty Haitilla tekemään ihmisistä zombeja.[3]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. a b Myrkyt luonnossa Sea Life
  2. Toshio Narahashi
  3. Don't Eat the Puffer Microcosm Aquarium Explorer

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]