Indigokarmiini

Wikipedia
Loikkaa: valikkoon, hakuun
Indigokarmiini
Indigo carmine.svg
Indigo-carmine-3D-balls.png
Tunnisteet
CAS-numero 860-22-0
IUPAC-nimi

dinatrium

(2E)-3-okso-2-(3-okso-5-sulfo-1H-indol-2-ylideeni)-1H-indoli-5-sulfonaatti
SMILES

C1=CC2=C(C=C1S(=O)(=O)O)C(=O)C(=C3C(=O)C4=C(N3)C=CC(=C4)S(=O)(=O)O)N2.

[Na+].[Na+] [1]
Ominaisuudet
Kemiallinen kaava C16H10N2Na2O8Ss
Moolimassa 468,38 g/mol
Liukoisuus 10 g/l [2]

Indigokarmiini (C16H10N2Na2O8S2) on väriaine. Indigokarmiinia käytetään kankaiden värjäyksessä [3], elintarvikevärinä (E132) [4] ja pH-indikaattorina. Indigokarmiini muuttaa väriään sinisestä keltaiseksi pH:n ollessa välillä 11,4–13,0 [5]. Indigokarmiinia voidaan käyttää myös redox-indikaattorina.

Jotkut voivat olla yliherkkiä indigokarmiinille, mikä ilmenee huononolontunteena, oksenteluna sekä ripulina [3]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Sachsischblau - Compound summary NCBI. Viitattu 14. lokakuuta 2008.
  2. Physical properties: Indigotindisulfonate Sodium NLM Viitattu 14.10.2008
  3. a b Indigokarmiini, seruliini (seruleiini) Coloria.net Päivi Hintsanen. Viitattu 14. lokakuuta 2008.
  4. E-koodiavain Evira. Viitattu 14. lokakuuta 2008.
  5. Liste des indicateurs colorés SBEC. Viitattu 14. lokakuuta 2008.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.