Estrioli

Wikipedia
Loikkaa: valikkoon, hakuun
Estrioli
Estriol.svg
Tunnisteet
CAS-numero 50-27-1
IUPAC-nimi

(8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,

17-dekahydrosyklopenta[a]fenantreeni-3,16,17-trioli
SMILES CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O [1]
Ominaisuudet
Kemiallinen kaava C18H24O3
Moolimassa 288,372 g/mol
Sulamispiste 282 °C [2]
Liukoisuus 0,441 g/l [2]

Estrioli (C18H24O3) on estrogeenihormoni, jota erittyy istukassa. Aine on heikohko hormoni, jonka määrä naisen elimistössä on suurin raskauden aikana.[3]

Estriolin hoitokäyttö[muokkaa | muokkaa wikitekstiä]

Estriolia käytetään muiden estrogeenien, kuten esimerkiksi estradiolin, tavoin vaihdevuosien aikaisena hormonihotona. Hormonin teho on kuitenkin heikompi kuin estradiolin.[4] Estrioli voi myös hidastaa MS-taudin aiheuttamia muutoksia aivoissa ja vaikuttaa taudin aktiivisuuteen.[5]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Estriol - Substance summary NCBI. Viitattu 21. joulukuuta 2008.
  2. a b Physical properties: Estriol NLM Viitattu 21.12.2008
  3. Estrioli Duodecim terveyskirjasto. Viitattu 21.12.2008.
  4. Olavi Ylikorkala: Menopaussin jälkeinen hormonihoito Duodecim terveyskirjasto. Viitattu 21.12.2008.
  5. Irina Elovaara ja Hanna Kuusisto: Naisen multippeliskleroosi. Duodecim, 2003, nro 119, s. 2037-2042. Duodecim. Artikkelin verkkoversio Viitattu 21.12.2008.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä biologiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.