Dietyylitryptamiini

Wikipedia
Loikkaa: valikkoon, hakuun
Dietyylitryptamiini
Diethyltryptamine.svg
Tunnisteet
CAS-numero 7558-72-7
IUPAC-nimi N,N-dietyyli-2-(1H-indol-3-yyli)etanamiini
SMILES CCN(CC)CCC1=CNC2=CC=CC=C21
Ominaisuudet
Kemiallinen kaava C14H20N2
Moolimassa 216,32 g/mol
Sulamispiste 169–171 °C

Dietyylitryptamiini (DET) eli N,N-dietyylitryptamiini on tryptamiineihin kuuluva huumausaine. Aine kuuluu tryptamiineihin, joihin kuuluvia huumeita ovat myös esimerkiksi joidenkin huumesienien sisältämä psilosybiini, sekä dimetyylitryptamiini (DMT).

Dietyylitryptamiinin kemiallinen kaava on C14H20N2 ja moolimassa 216,322 g/mol.

Lainsäädäntö[muokkaa | muokkaa wikitekstiä]

DET on Suomessa luokiteltu laittomaksi huumausaineeksi.[1]

Lähteet[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]