Auramiini

Wikipedia
Loikkaa: valikkoon, hakuun
Auramiini
Auramine O Formula V.1.svgSample of Auramine O.jpg
Tunnisteet
CAS-numero 492-80-8
IUPAC-nimi 4-[4-(dimetyyliamino)bentseenikarboksiimidoyyli]-N,N-dimetyylianiliini
SMILES CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C
Ominaisuudet
Kemiallinen kaava C17H21N3
Moolimassa 267,37 g/mol
Sulamispiste 136°C
Kiehumispiste 330,5°C

Auramiini eli 4,4‘-karbonimidoyylibis-N,N-dimetyylianiliini on keltainen tervaväri. Sitä käytetään muun muassa puuvillan, silkin ja paperin värjäykseen.[1] Auramiinin valmistukseen liittyy kasvanut riski sairastua syöpään.[2]

Auramiinin kemiallinen kaava on C17H21N3, moolimassa on  g/mol ja CAS-numero 492-80-8.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Forsman, J: "Pieni tietosanakirja.", sivu 251. Kustannusosakeyhtiö Otava, 1925–1928.
  2. Työministeriön päätös syöpäsairauden vaaraa aiheuttavista tekijöistä 16.9.1993/838, Finlex, 21.1.2010, viitattu 21.1.2010

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.