Adenosiini

Kohteesta Wikipedia
Loikkaa: valikkoon, hakuun
Adenosiini
Adenosin.svg
Tunnisteet
CAS-numero 58-61-7
IUPAC-nimi 2R,3R,4S,5R)-2-(6-aminopurin-9-yyli)-5-(hydroksimetyyli)oksolaani-3,4-dioli
SMILES C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CO)O)O
Ominaisuudet
Kemiallinen kaava C10H13N5O4
Moolimassa 267,242 g/mol
Sulamispiste 235,5°C[1]
Liukoisuus 8,23 g/l (25°C)[1]

Adenosiini on nukleosidi, joka koostuu adeniinista, joka liittyy riboosi-renkaaseen β-N9-glykosidisidoksella.

Adenosiini säätelee uni-valverytmiä kertymällä etuaivojen valvetta ylläpitävälle kolinergiselle alueelle. Adenosiiniin kertyminen hiljentää kolinergisen alueen toimintaa edesauttaen nukahtamista. Mitä pitempään valvominen kestää, sitä enemmän adenosiinia kertyy ja sitä suuremmaksi unipaine kasvaa[2].

Adenosiinin fosfaattijohdannaiset ovat keskeisiä biologisissa prosesseissa, kuten energian siirrossa: adenosiinitrifosfaatti (ATP) ja adenosiinidifosfaatti (ADP) ovat solujen energiatalouden tärkeimmät molekyylit. Syklinen adenosiinimonofosfaatti (cAMP) on erittäin yleinen molekyyli signaalinvälityksessä.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. a b Adenosine NLM Viitattu 14.06.2012
  2. Alanko Lauri 2005: Adenosine during prolonged wakefulness in the rat brain. Väitöskirja. Helsingin yliopiston lääketieteellinen tiedekunta. http://notes.helsinki.fi/halvi/tiedotus/vanhatvaitokset.nsf/504ca249c786e20f85256284006da7ab/08ba654401dce2f0c22570e6002de49d?OpenDocument

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.