Gliotoksiini

Wikipedia
Loikkaa: valikkoon, hakuun
Gliotoksiini
Gliotoxin.png
Tunnisteet
CAS-numero 67-99-2
SMILES CN1C(=O)C23CC4=CC=CC(C4N2C(=O)C1(SS3)CO)O
Ominaisuudet
Kemiallinen kaava C13H14N2O4S2
Moolimassa 326,391 g/mol g/mol
Sulamispiste 200-202 °C[1]
Liukoisuus 70 mg/l (30°C)[2]

Gliotoksiini on mykotoksiini, jolla on antibakteerisia ja antiviraalisia ominaisuuksia. Sitä ei käytetä kliinisessä käytössä toksisuutensa vuoksi.[3] Yhdisteen tuottajaksi tiedetään ainakin Aspergillus fumigatus. Gliotoksiini muokkaa ihmisen immuunivasteita ja saa aikaan apoptoosia erilaisissa solutyypeissä.[4]

Gliotoksiinin kemiallinen kaava on C13H14N2O4S2, moolimassa 326,391 g/mol ja CAS-numero 67-99-2.

Viitteet[muokkaa | muokkaa wikitekstiä]

  1. Gliotoxin Fermentek. Viitattu 16.8.2012.
  2. Physical properties: Gliotoxin NLM Viitattu 16.08.2012
  3. Kosalec I. & al.: Chemistry and biological effects of gliotoxin. Arh Hig Rada Toksikol., 2004, s. 55(4):313-20. PubMed.
  4. Daniel H. Scharf & al.: Biosynthesis and function of gliotoxin in Aspergillus fumigatus. Appl Microbiol Biotechnol, 2012, s. 93:467–472.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]