Ergoliini

Kohteesta Wikipedia
Loikkaa: valikkoon, hakuun
Ergoliini
Ergoline Structural Formulae V.1.svg
Tunnisteet
CAS-numero 478-88-6
IUPAC-nimi (6aR)- 4,6,6a,7,8,9,10,10a-oktahydroindolo [4,3-fg]kinoliini
SMILES C1C[C@H]2[C@@H](CC3=CNC4=CC=CC2=C34)NC1
Ominaisuudet
Kemiallinen kaava C14H16N2
Moolimassa 212,29 g/mol

Ergoliini on heterosyklinen kemiallinen yhdiste. Ergoliineja ovat alkaloidit, joiden rakenne pohjautuu ergoliinin rakenteeseen,[1] kuten esimerkiksi tietyt lysergamidit, peptidit ja torajyväalkaloidit.[2]

Ergoliinijohdannaisiin kuuluvaa 5-HT1-reseptoriin vaikuttavaa ergotamiinia käytetään migreenin sekä Parkinsonin taudin hoidossa ja ääreisverisuonten supistamiseen.[3]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Ergoliinit ONKI3. (englanniksi)
  2. PubChem NCBI. (englanniksi)
  3. Foye, William; Lemke, Thomas & Williams, David: Foye's Principles of Medicinal Chemistry, s. 414-415. Lippincott Williams & Wilkins, 2007. ISBN 978-0-7817-6879-5. Teoksen verkkoversio. (englanniksi)

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.