Alitsariinikeltainen R

Siirry navigaatioon Siirry hakuun
Alitsariinikeltainen R
Alizaringelb R.svg
CAS-numero 2243-76-7


SMILES C1=CC(=CC=C1NN=C2C=CC(=O)C(=C2)C(=O)O)[N+](=O)[O-] [1]
Kemiallinen kaava C13H9N3O5
Moolimassa 287,232 g/mol
Sulamispiste 253,5 °C[2]

Haitallinen aine[3]

Alitsariinikeltainen R (C13H9N3O5) on atsoväri. Ainetta on käytetty pH-indikaattorina sekä myös kankaiden värjäykseen. [4] Alitsariinikeltainen R muuttaa väriään keltaisesta punaiseksi, kun liuoksen pH on 10,1–12,0. [5] Ainetta myydään yleensä sen natriumsuolana.

Paitsi indikaattorina alitsariinikeltainen R:ää voidaan käyttää myös metallien kuten alumiinin, kuparin ja vanadiinin ionien erottamiseen. [6] Yhdiste on haitallista, jos se joutuu ihokosketukseen. Silmiin joutuessaan aine aiheuttaa vaikean tulehduksen. [7]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Pnbas - Compound summary NCBI. Viitattu 6. lokakuuta 2008.
  2. Physical properties:Alizarine Yellow R NLM Viitattu 6.10.2008
  3. Alitsariinikeltainen R Käyttöturvallisuustiedote. 13.9.2012. Sigma Aldrich (Merck). Viitattu 30.5.2018. (suomeksi)
  4. Alitsariinikeltainen Päivi Hintsanen. Viitattu 6. lokakuuta 2008.
  5. Liste des indicateurs colorés SBEC. Viitattu 6. lokakuuta 2008.
  6. The separation of aluminum(III) ions from the aqueous solution on membrane filter using Alizarin Yellow R. Nextbio. Viitattu 6. lokakuuta 2008.
  7. Material Safety Data Sheet : Alizarin yellow R Ntu Chemistry. Viitattu 6. lokakuuta 2008.
Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.