Kafestoli

Wikipedia
Loikkaa: valikkoon, hakuun
Kafestoli
Cafestol.svg
Tunnisteet
CAS-numero 469-83-0]
SMILES CC12CCC3=C(C1CCC45C2CCC(C4)C(C5)(CO)O)C=CO3
Ominaisuudet
Kemiallinen kaava C20H28O3
Moolimassa 316,439 g/mol
Sulamispiste 158–162 °C

Kafestoli on kahvissa oleva diterpenoidialkoholi. Kafestoli suurentaa veren LDL-kolesterolipitoisuutta ja voi olla yhteydessä joidenkin sydäntautien kehittymiseen. Suodatinkahvin valmistuksessa kafestoli jää paperisuodattimeen, eikä juomalla siksi ole mainittavaa vaikutusta kolesteroliin, mutta vanhaan malliin keitetyllä suodattamattomalla pannukahvilla on.[1][2]

Kafestoli suurentaa seerumissa alaniiniaminotransferaasin (ALAT) aktiivisuutta ja pienentää gammaglutamyylitransferaasin (GGT) aktiivisuutta, sekä vähentää kreatiniinipitoisuutta.[3]

Kafestolin CAS-numero on 469-83-0, kemiallinen kaava C20H28O3 ja moolimassa 316.439 g/mol.

Lähteet[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]