Akridiini

Wikipedia
Loikkaa: valikkoon, hakuun
Akridiini
Acridine chemical structure.png
Tunnisteet
CAS-numero 260-94-6
SMILES C1=CC=C2C(=C1)C=C3C=CC=CC3=N2
Ominaisuudet
Kemiallinen kaava C13H9N
Moolimassa 179,22 g/mol
Sulamispiste 107 °C
Kiehumispiste 346°C
Liukoisuus 38,4 mg/l (25°C)[1]

Akridiini C13H9N, on väriaineiden raaka-aine, jota saadaan kivihiilitervasta. Se on heterosyklinen aromaattinen orgaaninen yhdiste, joka tunnetaan karsinogeenisenä aineena. Akridiinin CAS-numero on 260-94-6.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Acridine NLM Viitattu 15.06.2012

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.