Parationi

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Parationi
Parathion Structural Formulae .V.1.svg
Tunnisteet
CAS-numero 56-38-2
IUPAC-nimi O,O-Dietyyli-O-(4-nitrofenyyli)fosforotioaatti
SMILES CCOP(=S)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-]
Ominaisuudet
Kemiallinen kaava C10H14NO5PS
Moolimassa 291,3 g/mol
Tiheys 1,26 g/cm³
Sulamispiste 6 °C
Kiehumispiste 375 °C
Liukoisuus 0,02 g/l

Parationi eli etyyliparationi eli dietyyli-p-nitrofenyylitiofosfaatti on kasvinviljelyssä käytetty hyönteismyrkky eli insektisidi. Parationi on hyvin myrkyllistä myös selkärankaisille eläimille. Aineen myynti ja käyttö kiellettiin Suomessa 1990-luvulla[1].

Parationi vaikuttaa hermostoa lamaavasti estämällä koliiniesteraasin toiminnan. Muun muassa Bladan on parationin kaupallinen myyntinimi.

Parationin eli etyyliparationin kemiallinen kaava on C10H14NO5PS ja rakennekaava (C2H5O)2PSOC6H4NO2.

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.
  1. http://www.finlex.fi/fi/laki/alkup/1996/19961361