Luminoli

Wikipedia
Loikkaa: valikkoon, hakuun
Luminoli
Luminol.png
Tunnisteet
CAS-numero 521-31-3
IUPAC-nimi 5-Amino-2,3-dihydro-1,4-ftaaliatsiinidioni
SMILES C1=CC2=C(C(=C1)N)C(=O)NNC2=O
Ominaisuudet
Kemiallinen kaava C8H7N3O2
Moolimassa 177,16 g/mol
Sulamispiste 319 °C

Luminoli (5-Amino-2,3-dihydro-1,4-ftaaliatsiinidioni eli C8H7N3O2) on kemiallinen yhdiste, jolla saadaan aikaan kemiluminesenssi, eli luminesenssi-ilmiö, jossa se vapauttaa kirkkaan sinistä valoa. Reaktiossa valon lisäksi ei kuitenkaan vapaudu lämpöä.

Usein kemiluminesenssin aikaansaamiseksi käytetään vetyperoksidia (H2O2) ja jokin hydroksidi veteen liuenneena sekä katalyyttinä toimivaa metallia esimerkiksi rautaa. Katalyytin avulla vetyperoksidi hajotetaan hapeksi ja vedeksi. Katalyyttina saataa toimia muun muassa veren hemoglobiinin sisältämä rauta ja bioluminesenssissä usein katalyyttinä toimivat erilaiset biologiset entsyymit.

Luminolin moolimassa on 177,16 g/mol, sulamispiste 319 °C ja CAS-numero 521-31-3.

Kemiluminesenssi luminolilla[muokkaa | muokkaa wikitekstiä]

Luminoli + H2O2 + OH- (+ katalyytti) → Virittynyt Dianioni (3-aminoftaaliatsiini) + O2 → 3-aminoftaaliatsiini + valoa + N2 + H2O (+ katalyytti)

Luminolin avulla aikaansaatu kemiluminesenssi, jossa vapautuu valoa (hv)
Luminoli ja hemoglobiini.

Luminolin käyttötavat[muokkaa | muokkaa wikitekstiä]

Luminolia hyodynnetään muun muassa verijälkien löytämiseksi poliisitutkinnassa. Tässä kemiluminesenssissä katalyyttina on veren hemoglobiinin sisältämä rauta. Valotikuissa käytetään useimmiten dibentsoyyliperoksidia (kauppanimi Cyalume), joka aiheuttaa vetyperoksidin kanssa kemiluminesenssin.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Katso myös[muokkaa | muokkaa wikitekstiä]