Nopea keltainen AB

Wikipedia
Loikkaa: valikkoon, hakuun
Nopea keltainen AB
Fast Yellow AB.png
Tunnisteet
CAS-numero 2706-28-7
IUPAC-nimi 2-amino-5-[(E)-(4-sulfonaattofenyyli)diatsenyyli]bentseenisulfoni happo
SMILES Nc1ccc(cc1OS(O)=O)/N=N/c2ccc(OS(O)=O)cc2
Ominaisuudet
Kemiallinen kaava C12H11N3O6S2
Moolimassa 357.36 g/mol
Sulamispiste 300 ºC
Liukoisuus 260 g/L (30 ºC)

Nopea keltainen AB on atsoväri, jolla oli E-koodi E105. Väri poistettiin ruoassa ja juomassa sallituista lisäaineista sekä E-koodiluettelosta[1], koska sen toksikologia osoitti sen haitalliseksi. Sen on epäilty aiheuttavan astmaa.[2]

Viitteet[muokkaa | muokkaa wikitekstiä]

Katso myös[muokkaa | muokkaa wikitekstiä]