Gibberelliinihappo

Wikipedia
Loikkaa: valikkoon, hakuun
Gibberelliinihappo
Gibberellic acid.svg
Tunnisteet
CAS-numero 77-06-5
SMILES CC12C(C=CC3(C1C(C45C3CCC(C4)(C(=C)C5)O)C(=O)O)OC2=O)O
Ominaisuudet
Kemiallinen kaava C19H22O6
Moolimassa 346,374 g/mol
Sulamispiste 233 - 235 °C
Liukoisuus 5 g/l (20 °C)

Gibberelliinihappo eli gibberelliini A3 on kasvihormoni. Hormonia käytetään erilaisten kasvien kestävyyden parantamisessa esimerkiksi parantamaan kuljetuskestävyyttä.

Gibberelliinihapon kemiallinen kaava on C19H22O6, moolimassa 346,374 g/mol ja CAS-numero 77-06-5.

Katso myös[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]