Guanosiinitrifosfaatti

Kohteesta Wikipedia
(Ohjattu sivulta GTP)
Siirry navigaatioon Siirry hakuun
Guanosiinitrifosfaatti
GTP chemical structure.png
Tunnisteet
CAS-numero 86-01-1
SMILES C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N
Ominaisuudet
Kemiallinen kaava C10H16N5O14P3
Moolimassa 523,18 g/mol

Guanosiinitrifosfaatti (guanosiini-5'-trifosfaatti, GTP) on eräs puriininukleotidi. GTP toimii substraattina RNA-synteesissä, samoin kuin adenosiinitrifosfaatti eli ATP, sytidiinitrifosfaatti eli CTP ja uridiinitrifosfaatti eli UTP. GTP on guanidiininukleotidi kuten guanosiinidifosfaatti eli GDP, josta se poikkeaa ainoastaan fosfaattiryhmien lukumäärän perusteella. GTP toimii myös energianlähteenä ja useiden metaboliareaktioiden aktivaattorina. GTP:llä on myös tärkeä tehtävä G-proteiinien signaalivälityksessä, jossa se muuntuu GDP:ksi GTPaasien välityksellä.

Guanosiinitrifosfaatin kemiallinen kaava on C10H16N5O14P3 ja moolimassa 523,18 g/mol. Sen CAS-numero 86-01-1[1].

Katso myös guanosiinidifosfaatti (C10H15N5O11P2) eli GDP.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Guanosiinitrifosfaatti terveysportti.fi. Viitattu 8.7.2010.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä biologiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.