
Siirry navigaatioon Siirry hakuun
CAS-numero 125-20-2
IUPAC-nimi 3,3-bis(4-hydroksi-2-metyyli-5-propan-2-yylifenyyli)-2-bentsofuran-1-oni
SMILES CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O [1]
Kemiallinen kaava C28H30O4
Moolimassa 430,52 g/mol
Sulamispiste 253 °C[2]

Tymoliftaleiini on väriaine, jota käytetään pH-indikaattorina [3]. Se muuttuu värittömästä siniseksi, kun pH nousee 9,4:stä 10,6:een[4]. Ainetta käytetään yleensä liuotettuna etanolin ja veden seokseen[4].

Synteesi[muokkaa | muokkaa wikitekstiä]

Tymoliftaleiinia valmistetaan kuumentamalla tymolia ja ftaalianhydridiä happamissa olosuhteissa.[5]


Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Thymophthalein - Compound summary NCBI. Viitattu 2.10.2008.
  2. Physical properties:Thymolphthalein NLM Viitattu 2.10.2008
  3. värejä... T Coloria.net Päivi Hintsanen. Viitattu 2. lokakuuta 2008.
  4. a b Liste des indicateurs colorés SBEC. Viitattu 2.10.2008.
  5. Raimo Alén: Kokoelma orgaanisia yhdisteitä, s. 851. Consalen Consulting, 2009. ISBN 978-952-92-5627-3.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.