Ero sivun ”Paraoranssi” versioiden välillä

Siirry navigaatioon Siirry hakuun
16 merkkiä lisätty ,  1 vuosi sitten
p
tarkistettu lähde, haetaan mieluummin InChl-avaimella niin menee heti oikean yhdisteen kohdalle
p (tarkistettu lähde, haetaan mieluummin InChl-avaimella niin menee heti oikean yhdisteen kohdalle)
| sulamispiste = 300 °C
| kiehumispiste =
| liukoisuus = 1,9·10<sup>5</sup><ref>{{Verkkoviite|Julkaisija=NLM|Vuosi=|Nimeke=Physical Properties: FDSubstance &Name: C.I. Food Yellow No3 RN: 2783-94-0|Osoite=https://chem.nlm.nih.gov/chemidplus/inchikey/oiqptrohqcgfef-qikyxugxsa-l|Luettu=22. maaliskuuta 62020}}</ref>
RN: 2783-94-0|Osoite=http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/PhysicalProperties.jsp|Luettu=30. toukokuuta 2008}}</ref>
| smiles = C1=CC(=CC=C1NN=C2C3=C(C=CC2=O)C=C(C=C3)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+]
.[Na+]<ref>{{Verkkoviite|Julkaisija=NCBI|Vuosi=|Nimeke=PubChem: Sunset yellow - Substance Summary |Osoite=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?sid=160862&loc=ec_rcs|Luettu=30. toukokuuta 2008}}</ref>
21 923

muokkausta

Navigointivalikko