Skatoli

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Skatoli
Skatole structure.svg
Skatole 3d structure.png
Tunnisteet
CAS-numero 83-34-1
IUPAC-nimi 3-metyyli-indoli
SMILES C1=C2C(=CC=C1)C(=C[N]2C)C
Ominaisuudet
Kemiallinen kaava C9H9N
Moolimassa 131,172 g/mol
Sulamispiste 93–95 °C (366–368 K)
Kiehumispiste 265 °C (538 K)
Liukoisuus veteen 0,498 g/l

Skatoli eli 3-metyyli-indoli[1] (C9H9N) on lievästi myrkyllinen orgaaninen yhdiste. Skatoli on puhtaana aineena valkoista, kiteistä ja epämiellyttävän hajuista, ja se tummuu ilman ja valon vaikutuksesta. Skatoli liukenee kuumaan veteen, asetoniin, kloroformiin, etanoliin, eetteriin ja bentseeniin.

Skatoli on merkittävä ulosteiden hajun aiheuttaja, sitä muodostuu nisäkkäiden ruoansulatuskanavassa mikrobien hajottaessa tryptofaanin ensin indoliksi ja siitä edelleen skatoliksi. Hyvin pieninä konsentraatioina sitä on kuitenkin aromiaineena useissa tuoksuvissa kukissa ja eteerisissä öljyissä. Sitä käytetään myös esimerkiksi hajusteiden ainesosana.[2]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Karhunpää, Maija: Laktitolin vaikutus karjunhajun muodostumiseen Maa- ja elintarviketalouden tutkimuskeskus. Viitattu 2.5.2011.
  2. Mirsky, Steve: O Mercaptan, My Mercaptan. Scientific American, toukokuu 2011, nro 304, s. 74. (englanniksi)

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]