Kalsidioli

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Kalsidioli
Calcidiol2.svg
Tunnisteet
CAS-numero 19356-17-3
SMILES C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C
Ominaisuudet
Kemiallinen kaava C27H44O2
Moolimassa 400,6426 g/mol

Kalsidioli eli 25-hydroksikolekalsiferoli (lyhennetään 25(OH)D) on aktiivisen D-vitamiinin esiaste. Sen kemiallinen kaava on C27H44O2 ja moolimassa 400,6426 g/mol.[1]

Maksa muodostaa kalsidiolia kolekalsiferolista eli D3-vitamiinista. Osa kalsidiolista muuttuu elimistössä kalsitrioliksi, joka on varsinainen hormonaalisesti aktiivinen D-vitamiinin aineenvaihduntamuoto.[2]

Elimistön D-vitamiinitilannetta määritettäessä mitataan nimenomaan seerumin kalsidiolipitoisuutta, joka antaa parhaan käsityksen D-vitamiinivarastosta.[2] Kalsidiolilla voidaan hoitaa riisitautia ja osteomalasiaa.[1]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. a b Substance Name: Calcifediol (INN) Toxnet. Bethesda, Maryland: U.S. National Library of Medicine. Viitattu 5.1.2017. (englanniksi)
  2. a b D2- ja D3-vitamiinien erot (Ks. myös kalsidioli-sanan Alt-teksti) dvitamiini.fi. Orion Oyj. Viitattu 5.1.2017.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]