Genisteiini

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
Genisteiini
Genistein.svg
Tunnisteet
CAS-numero 446-72-0
IUPAC-nimi 5,7-dihydroksi-3-(4-hydroksifenyyli)kromen-4-oni
SMILES C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O
Ominaisuudet
Kemiallinen kaava C15H10O5
Moolimassa 270,24 g/mol
Sulamispiste 297–298 °C

Genisteiini eli genisteini (C15H10O5) on isoflavoneihin kuuluva flavonoidi.[1] Genisteiiniä esiintyy kasveissa kuten esimerkiksi sinimailasessa (Medicago sativa).[1] Eläimissä se saa aikaan estrogeenisiä vaikutuksia.[1] Genisteiini löydettiin ensimmäisen kerran pensasväriherneestä (Genista tinctoria) 1899, jonka suvun tieteellisestä nimestä aine on saanut nimensä.

Genisteiinin moolimassa on 270.24 g/mol, sulamispiste 297–298 °C ja CAS-numero 446-72-0. Genisteiini ei liukene veteen.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. a b c Turunen, Seppo: Biologia: Ihminen, s. 177. 5.–7. painos. WSOY, 2007. ISBN 978-951-0-29701-8.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä biologiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.