Avitsafoni

Kohteesta Wikipedia
Loikkaa: valikkoon, hakuun

{{lääketietolaatikko |

| IUPAC_nimi                    = (2S)-2,6-diamino-N-{[(2-benzoyl-4-chlorophenyl)methylcarbamoyl]methyl}hexanamide
| image                         = Avizafone.svg
| kuvateksti                    = Avitsafoonin molekyylirakenne.
| width                         = 200
| image2                        =
| kuvateksti2                   =
| CAS_numero                    = 65617-86-9
| CAS_lisätiedot                =
| ATC_prefiksi                  = 
| ATC_suffiksi                  =
| ATC_lisätiedot                =
| PubChem                       = 71968
| DrugBank                      =
| kemiallinen_kaava             =
| C=22 | H=27 | N=4 | Co= | I= | Br= | Cl=1 | F= | O=3 | P= | S= | Se= | Na= | charge=
| moolimassa                    = 430.928 g/mol
| smiles                        = Clc1cc(c(N(C(=O)CNC(=O)[C@@H](N)CCCCN)C)cc1)C(=O)c2ccccc2
| synonyymit                    =
| tiheys                        =
| sulamispiste                  =
| sulamis_ylempi                =
| sulamishuomiot                =
| kiehumispiste                 =
| kiehumis_ylempi               =
| kiehumishuomiot               =
| liukoisuus                    =
| spesifinen_rotaatio           =
| sem_kombustio                 =
| biosaatavuus                  =
| proteiinisitoutuminen         =
| metabolismi                   =
| eliminaation_puoliintumisaika =
| ekskreetio                    =
| lupatiedot_EU                 =  
| lupatiedot_US                 =  
| raskaus_AU                    =  
| raskaus_US                    =  
| raskauskategoria              =
| resepti_AU                    =  
| resepti_CA                    =  
| resepti_FI                    =  
| resepti_UK                    =  
| resepti_US                    =  
| reseptiluokitus               =
| riippuvuusalttius             =
| valmisteen_antotapa           =

}}

Avitsafoni on vesiliukoinen diatsepaamin aihiolääke, jota voidaan annostella intramuskulaarisesti.

Veren entsyymit hajottavat avitsafonin diatsepaamiksi, ja sitä käytetään pääasiallisesti vastalääkkeenä organofosfaattimyrkytykseen.[1][2][3]

Avitsafonin kemiallinen kaava on C22H27CIN4O3, moolimassa 430.928 g/mol ja CAS-numero 65617-86-9.

Katso myös[muokkaa | muokkaa wikitekstiä]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Karlsson B, Lindgren B, Millquist E, Sandberg M, Sellstrom A. On the use of diazepam and pro-diazepam (2-benzoyl-4-chloro-N-methyl-N-lysylglycin anilide), as adjunct antidotes in the treatment of organophosphorus intoxication in the guinea-pig. Journal of Pharmacy and Pharmacology. 1990 Apr;42(4):247-51.
  2. Lallement G, Renault F, Baubichon D, Peoc'h M, Burckhart MF, Galonnier M, Clarencon D, Jourdil N. Compared efficacy of diazepam or avizafone to prevent soman-induced electroencephalographic disturbances and neuropathology in primates: relationship to plasmatic benzodiazepine pharmacokinetics. Archives of Toxicology. 2000 Oct;74(8):480-6.
  3. Taysse L, Calvet JH, Buee J, Christin D, Delamanche S, Breton P. Comparative efficacy of diazepam and avizafone against sarin-induced neuropathology and respiratory failure in guinea pigs: influence of atropine dose. Toxicology. 2003 Jun 30;188(2-3):197-209.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]