2-arakidonyyliglyseroli

Kohteesta Wikipedia
Siirry navigaatioon Siirry hakuun
2-arakidonyyliglyseroli
2-Ara-Gl.svg
Tunnisteet
CAS-numero 53847-30-6
IUPAC-nimi 1,3-dihydroksipropan-2-yyli-(5Z,8Z,11Z,14Z)-ikosa-5,8,11,14-tetraenoaatti
SMILES CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(CO)CO
Ominaisuudet
Kemiallinen kaava C23H38O4
Moolimassa 378,30 g/mol

Helposti syttyvä Haitallinen / ärsyttävä[1]

2-arakidonoyyliglyseroli (2-AG) on anandamidin ohella toinen tärkeä sisäsyntyinen eli endogeeninen kannabinoidi (endokannabinoidi), joka sitoutuu kannabinoidireseptoreihin. 2-arakidonyyliglyseroli on anandamidin tavoin paikallisesti syntyvä arakidonihapon johdannainen.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Stella, N., Schweitzer, P., Piomelli, D. A second endogenous cannabinoid that modulates long-term potentiation. Nature 388 773-778 (1997)

Viitteet[muokkaa | muokkaa wikitekstiä]

  1. 2-Arakidonyyliglyseroli Käyttöturvallisuustiedote. 13.9.2017. Sigma Aldrich (Merck). Viitattu 3.9.2018.

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.