Trifenyylifosfiini

Wikipedia
Loikkaa: valikkoon, hakuun
Trifenyylifosfiini
Triphenylphosphine structure.svg
Triphenylphosphine-ray-3D-balls.png
Tunnisteet
CAS-numero 603-35-0
SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 [1]
Ominaisuudet
Kemiallinen kaava C18H15P
Moolimassa 262,27 g/mol
Tiheys 1,1 g/cm³
Sulamispiste 80°C [2]
Kiehumispiste 377°C
Liukoisuus Veteen liukenematon

Trifenyylifosfiini eli trifenyylifosfori (C18H15P) on yleisesti käytetty orgaaninen fosforiyhdiste. Ainetta käytetään laajasti orgaanisten ja organometalliyhdisteiden synteesissä. Trifenyylifosfori kirjoitetaan yleisesti lyhennettynä muotoon PPh3 tai Ph3P. Huoneenlämpötilassa trifenyylifosfiinin on veteen liukenemattomia värittömiä kiteitä [2]. Trifenyylifosfiini voidaan liuottaa poolittomiin liuottimiin kuten bensiiniin tai dietyylieetteriin. Trifenyylifosfiinin metallijohdannaisia käytetään usein katalyytteinä.

Reaktioita[muokkaa | muokkaa wikitekstiä]

Trifenyylifosfiinin hapettuminen[muokkaa | muokkaa wikitekstiä]

Trifenyylifosfiini reagoi hitaasti ilmassa muodostaen trifenyylifosfiinioksidia

2 PPh3 + O2 → 2 OPPh3

Yksi tapa hapettaa trifenyylifosfiinia on myös sen reaktio orgaanisten peroksidien kanssa.

PPh3 + RO2H → OPPh3 + ROH

Staudinger-reaktio[muokkaa | muokkaa wikitekstiä]

Staudinger-reaktiossa atsideista tehdään amiineja usean katalyytin avulla. Trifenyylifosfiini muodostaa atsidin kanssa fosfatsidin, jonka menettäessä typpimolekyyli syntyy iminofosforaani. Iminofosforaaniin lisättäessä vettä se hajoaa muodostaen amiinin.[3]

PPh3 + PhN3 → PhNPPh3 + N2
PPh3 + RN3 + H2O → OPPh3 + N2 + RNH2

Appel-reaktio[muokkaa | muokkaa wikitekstiä]

Appel-reaktiossa trifenyylifosfiini hapettuu ensin trifenyylifosfiiniosidiksi, joka katalysoi alkoholin reaktiota alkyylihalidiksi yleensä bromidiksi tai kloridiksi.[4]

PPh3 + CBr4 + RCH2OH → OPPh3 + RCH2Br + HCBr3

Turvallisuus[muokkaa | muokkaa wikitekstiä]

Trifenyylifosfiini ärsyttää hengitysteitä ja silmiä. Aine on palavaa ja voi muodostaa myrkyllisiä palokaasuja kuten fosfiinia sekä fosforin oksideja.[2].

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Triphenylphosphine - Compound summary NCBI. Viitattu 18. lokakuuta 2008.
  2. a b c Trifenyylifosfiini IPCS. Viitattu 18. lokakuuta 2008.
  3. Staudinger Reaction Organic Chemistry Portal. Viitattu 18. lokakuuta 2008.
  4. Appel Reaction Organic Chemistry Portal. Viitattu 18. lokakuuta 2008.