Sinappihappo

Wikipedia
Loikkaa: valikkoon, hakuun
Sinappihappo
Sinapic acid.png
Tunnisteet
CAS-numero 530-59-6
IUPAC-nimi (E)-3-(4-hydroksi-3,5-dimetoksifenyyli)prop-2-eenihappo
SMILES COC1=CC(=CC(=C1O)OC)C=CC(=O)O
Ominaisuudet
Kemiallinen kaava C<sub11H12O5
Moolimassa 224,21 g/mol
Sulamispiste 203-205 °C

Sinappihappo on luonnossa, mm. sinapin siemenissä esiintyvä orgaaninen happo.