Naringetiini

Wikipedia
Loikkaa: valikkoon, hakuun
Naringetiini
Naringenin.svg
Tunnisteet
CAS-numero 480-41-1
IUPAC-nimi (2S)-5,7-dihydroksi-2-(4-hydroksifenyyli)-2,3-dihydrokromen-4-oni
SMILES C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O
Ominaisuudet
Kemiallinen kaava C15H12O5
Moolimassa 272,253 g/mol
Sulamispiste 251°C
Liukoisuus Veteen 0,475 g/l (25°C)[1]

Naringetiini on flavonoidi, jota esiintyy runsaasti greipissä. Sillä voi olla eräiden lääkkeiden kanssa haitallisia yhteisvaikutuksia, joten greippiä tai sitä sisältäviä tuotteita ei pidä nauttia, jos käyttää lääkkeitä. Tunnettuja tällaisia lääkkeitä ovat ainakin verenpaine-, nukahtamis-, kolesteroli- ja reumalääkkeet. Naringetiini vaikuttaa maksan toimintaan ja sitä kautta se joko heikentää tai vahvistaa lääkkeen tehoa.[2]

Sinänsä naringetiinilla on todettu myönteisiä vaikutuksia muun muassa viruksiin, mitä tutkitaan parhaillaanmilloin?.[3]. Sen vaikutusta on tutkittu myös hiirillä, joilta puuttuu LDL-reseptori.[4]

Naringetiinin kemiallinen kaava on C15H12O5, moolimassa 272,253 g/mol, sulamispiste 251 °C ja CAS-numero 480-41-1.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Physical properties: Naringenin NLM Viitattu 10.06.2012
  2. Greippimehu + lääke Uku.fi. Viitattu 13.11.2010.
  3. A Pilot Study of the Grapefruit Flavonoid Naringenin for HCV Infection, viitattu 13.11.2010
  4. "Naringenin prevents dyslipidemia, apoB overproduction and hyperinsulinemia in LDL-receptor null mice with diet-induced insulin resistance", viitattu 13.11.2010

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.