Kurkumiini

Wikipedia
Loikkaa: valikkoon, hakuun
Kurkumiini
CurcuminKeto.svg
Tunnisteet
CAS-numero 458-37-7
IUPAC-nimi (1E,6E)-1,7-bis(4-hydroksi-3-metoksifenyyli)hepta-1,6-dieeni-3,5-dioni
SMILES COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O
Ominaisuudet
Kemiallinen kaava C21H20O6
Moolimassa 368,38 g/mol g/mol
Sulamispiste 183 °C

Kurkumiini eli diferoyylimetaani on maustekurkuman (Curcuma longa) juurista uutettavaa ainetta, jota käytetään elintarvikkeissa väriaineena. Kurkumiinin E-koodi on E 100.

Kurkumiinin on eräässä tutkimuksessa todettu säännöllisesti nautittuna estävän diabeteksen puhkeamisen.[1]

Kurkumiinin uuttamisessa saa käyttää ainoastaan seuraavia liuottimia: etyyliasetaatti, asetoni, hiilidioksidi, dikloorimetaani, n-butanoli, metanoli, etanoli, heksaani, 2-propanoli.[2]

Kurkumiinin kemiallinen kaava on C21H20O6, moolimassa 368,38 g/mol ja CAS-numero 458-37-7. Yhdiste kuuluu kurkuminoidien aineryhmään, johon kuuluu myös demetoksikurkumiini C20H18O5 ja bisdemetoksikurkumiini C19H16O4.lähde?

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Yle uutiset viitattu 30.7.2012
  2. Eur-lex.europa.eu: E 100 Kurkumiini, Eur-Lexissä

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.