Kalsitrioli

Wikipedia
Loikkaa: valikkoon, hakuun
Kalsitrioli
Calcitriol.svg
Tunnisteet
CAS-numero 32222-06-3
SMILES CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O)O)C
Ominaisuudet
Kemiallinen kaava C27H44O3
Moolimassa 416,636 g/mol
Sulamispiste 113 °C
Kalsitriolin aineenvaihduntatuote on kalsitroiinihappo.

Kalsitrioli eli 1,25-dihydroksikolekalsiferoli on D3-vitamiinin aktiviinen muoto (lyhennetään 1,25-(OH)2D3 tai yksinkertaisesti 1,25(OH)2D). Munuaiset valmistavat kalsitriolia kalsidiolista (C27H44O2). Kalsitrioli metaboloituu munuaisissa kalsitrioli 24-hydroksylaasin entsyymin katalysoimana edelleen vesiliukoiseksi kalsitroikhapoksi (1α-hydroksi-23-karboksi-24,25,26,27-tetranorvitamiini D3) joka poistuu elimistöstä virtsan mukana.

Kalsitriolin kemiallinen kaava on C27H44O3, moolimassa 416,636 g/mol, sulamispiste 113 °C ja CAS-numero 32222-06-3.

Kalsitrioli tehostaa kalsiumin ja fosfaatti-ionien imeytymistä suolistosta.[1]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Hiltunen, Holmberg, Jyväsjärvi, Kaikkonen, Lindblom-Ylänne, Nienstedt, Wähälä: Galenos - Johdanto lääketieteen opintoihin, s. 426. Helsinki: WSOYpro, 2010. ISBN 978-951-0-33085-2.

Katso myös[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]