Isomalti

Wikipedia
Loikkaa: valikkoon, hakuun
Isomalti
IsomaltSkeletal.svg
Tunnisteet
CAS-numero 64519-82-0
IUPAC-nimi (2R,3R,4R,5R)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroksi-6-(hydroksimetyyli)oksan-2-yyli]oksiheksaani-1,2,3,4,5-pentoli
SMILES C(C1C(C(C(C(O1)OCC(C(C(C(CO)O)O)O)O)O)O)O)O
Ominaisuudet
Kemiallinen kaava C12H24O11
Moolimassa 344,312 g/mol

Isomalti on makeutusaine ja sokerialkoholi, jota käytetään sokerin korvikkeena. Se on glukoosin ja maltitolin disakkaridi.[1]

Isomalti poikkeaa sokerista siinä, ettei se vaikuta veren sokeriarvoihin, koska se käyttäytyy ruoansulatuksessa niin kuin ruokakuitu.[1] Isomalti ei myöskään ole yhtä haitallinen hampaille kuin sokeri.[2]

Kemiallinen rakenne[muokkaa | muokkaa wikitekstiä]

Isomaltin kemiallinen kaava on C12H24O11, CAS-numero 64519-82-0, moolimassa 344,312 g/mol ja E-koodi E953.[3][1]

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. a b c E953 isomalti, isomaltitoli finland.somefood.org. Viitattu 18.7.2013.
  2. Lisäaineiden abc - Artikkelit - Kiloklubi kiloklubi.fi. Viitattu 24.7.2013.
  3. [Untitled] fao.org. Viitattu 18.7.2013 (englanniksi).
Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.