Ferulahappo

Wikipedia
Loikkaa: valikkoon, hakuun
Ferulahappo
Ferulic acid2.png
Tunnisteet
CAS-numero 1135-24-6
IUPAC-nimi (E)-3-(4-hydroksi-3-metoksifenyyli)prop-2-eenihappo
SMILES COC1=C(C=CC(=C1)C=CC(=O)O)O
Ominaisuudet
Kemiallinen kaava C10H10O4
Moolimassa 194,18 g/mol
Sulamispiste 168–172 °C

Ferulahappo (eli 4-hydroksi-3-metoksikanelihappo) on yksinkertainen aromaattinen kanelihappo. Sillä voidaan parantaa esimerkiksi marjamehujen väriä.[1] Luontaislääkinnässä ferulahappo on kouristuksen laukaisija ja vähentää punaisten verisolujen aggregaatiota. Eräässä tutkimuksessa havaittiin, että lääkeyrteissä ja marjoissa esiintyvä ferulahappo vähentää kohdun kouristuksia.[2] Ferulahappoa on marjojen, etenkin pihlajanmarjan, lisäksi myös esimerkiksi viljan oljissa ja männyn kuoressa.

Ferulahapon kemiallinen kaava on C10H10O4 ja CAS-numero 1135-24-6.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Marjojen antosyaaniväreistä uutta tietoa elintarviketeollisuuden tarpeisiin
  2. Kiinan angelika eli danggui

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.