Estroni

Wikipedia
Loikkaa: valikkoon, hakuun
Estroni
Estron.svg
Tunnisteet
CAS-numero 53-16-7
SMILES CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)O
Ominaisuudet
Kemiallinen kaava C18H22O2
Moolimassa 270,366 g/mol
Sulamispiste 254,5°C
Liukoisuus Veteen 30 mg/l (25°C)[1]

Estroni (C18H22O2) on yksi estrogeenihormoneista. Kolmesta estrogeenihormonista estronia esiintyy naisen ruumiissa vähiten. Estronin johdannaisesta estronisulfaatista voidaan tuottaa estradiolia.

Estronin moolimassa on 270,366 g/mol, sulamispiste 254,5 °C ja CAS-numero 53-16-7.

Biosynteesi[muokkaa | muokkaa wikitekstiä]

Androstenedioinin reaktio estroniksi

Estronia tuotetaan munasarjoissa aromataasin avulla androstenedionista estroniksi. Reaktiossa androstenedionin yhdeksästoista hiiliatomi poistetaan demetylaatioreaktiolla.

Katso myös[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

  1. Estrone NLM Viitattu 13.06.2012
Tämä biologiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.