4-metyyliaminoreksi

Wikipedia
Loikkaa: valikkoon, hakuun
4-metyyliaminoreksi
4-Methyl-Aminorex.svg
Tunnisteet
CAS-numero 3568-94-3
IUPAC-nimi 4-metyyli-5-fenyyli-4,5-dihydro-1,3-oksatsol-2-amiini
SMILES CC1C(OC(=N1)N)C2=CC=CC=C2
Ominaisuudet
Kemiallinen kaava C10H12N2O
Moolimassa 176,215 g/mol
Sulamispiste 154,5-156°C

4-metyyliaminoreksi on huumaava piristekemikaali. Se on metamfetamiinin kaltainen, mutta sillä on pitempi vaikutusaika.

4-metyyliaminoreksin kemiallinen kaava on C10H12N2O, moolimassa 176,215 g/mol ja CAS-numero 3568-94-3.

4-metyyliaminoreksi on Suomessa luokiteltu laittomaksi huumeeksi.

Katso myös[muokkaa | muokkaa wikitekstiä]

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]