2-arakidonyyliglyseroli

Wikipedia
Loikkaa: valikkoon, hakuun
2-arakidonyyliglyseroli
2-AG.png
Tunnisteet
CAS-numero 53847-30-6
IUPAC-nimi 1,3-dihydroksipropan-2-yyli-(5Z,8Z,11Z,14Z)-ikosa-5,8,11,14-tetraenoaatti
SMILES CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(CO)CO
Ominaisuudet
Kemiallinen kaava C23H38O4
Moolimassa 378,30 g/mol

2-arakidonyyliglyseroli (2-AG) on anandamidin ohella toinen tärkeä sisäsyntyinen eli endogeeninen kannabinoidi (endokannabinoidi), joka sitoutuu kannabinoidireseptoreihin. 2-arakidonyyliglyseroli on anandamidin tavoin paikallisesti syntyvä arakidonihapon johdannainen.

Lähteet[muokkaa | muokkaa wikitekstiä]

  1. Stella, N., Schweitzer, P., Piomelli, D. A second endogenous cannabinoid that modulates long-term potentiation. Nature 388 773-778 (1997)

Aiheesta muualla[muokkaa | muokkaa wikitekstiä]

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.